About [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid
[4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid (PubChem CID 129248000) has the molecular formula C11H20F2N2O2
and a molecular weight of 250.29 g/mol. Its IUPAC name is [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid |
| PubChem CID | 129248000 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid |
| SMILES | CC(NCC1CCC(NC(=O)O)CC1)C(F)F |
| InChI | InChI=1S/C11H20F2N2O2/c1-7(10(12)13)14-6-8-2-4-9(5-3-8)15-11(16)17/h7-10,14-15H,2-6H2,1H3,(H,16,17) |
| InChIKey | UAHXBRDGWYRLCP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid?
The IUPAC name of [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid (CID 129248000) is [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid.
What is the SMILES notation for [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid?
The canonical SMILES for [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid is CC(NCC1CCC(NC(=O)O)CC1)C(F)F.
What is the InChIKey of [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid?
The InChIKey is UAHXBRDGWYRLCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O2/c1-7(10(12)13)14-6-8-2-4-9(5-3-8)15-11(16)17/h7-10,14-15H,2-6H2,1H3,(H,16,17).
What are the key properties of [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid?
[4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid has a molecular weight of 250.29 g/mol, XLogP of 2.06, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1,1-difluoropropan-2-ylamino)methyl]cyclohexyl]carbamic acid is sourced from PubChem (CID 129248000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).