About 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile
3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile (PubChem CID 129248437) has the molecular formula C15H13BrF2N4
and a molecular weight of 367.20 g/mol. Its IUPAC name is 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile |
| PubChem CID | 129248437 |
| Molecular Formula | C15H13BrF2N4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)nn(C2CCCC2)c1-c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H13BrF2N4/c16-8-5-11(17)13(12(18)6-8)14-10(7-19)15(20)21-22(14)9-3-1-2-4-9/h5-6,9H,1-4H2,(H2,20,21) |
| InChIKey | AYLTWJWUVHHGFC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile?
The IUPAC name of 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile (CID 129248437) is 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile.
What is the SMILES notation for 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile?
The canonical SMILES for 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile is N#Cc1c(N)nn(C2CCCC2)c1-c1c(F)cc(Br)cc1F.
What is the InChIKey of 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile?
The InChIKey is AYLTWJWUVHHGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrF2N4/c16-8-5-11(17)13(12(18)6-8)14-10(7-19)15(20)21-22(14)9-3-1-2-4-9/h5-6,9H,1-4H2,(H2,20,21).
What are the key properties of 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile?
3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile has a molecular weight of 367.20 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(4-bromo-2,6-difluorophenyl)-1-cyclopentylpyrazole-4-carbonitrile is sourced from PubChem (CID 129248437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).