C13H15BrN2O2 — CID 129248659
(4aS,10bR)-9-bromo-6-ethyl-2,4,4a,10b-tetrahydro-1H-pyrano[3,4-c][1,8]naphthyridin-5-one (PubChem CID 129248659) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is (4aS,10bR)-9-bromo-6-ethyl-2,4,4a,10b-tetrahydro-1H-pyrano[3,4-c][1,8]naphthyridin-5-one.
| Compound Name | (4aS,10bR)-9-bromo-6-ethyl-2,4,4a,10b-tetrahydro-1H-pyrano[3,4-c][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 129248659 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (4aS,10bR)-9-bromo-6-ethyl-2,4,4a,10b-tetrahydro-1H-pyrano[3,4-c][1,8]naphthyridin-5-one |
| SMILES | CCN1C(=O)[C@@H]2COCC[C@H]2c2cc(Br)cnc21 |
| InChI | InChI=1S/C13H15BrN2O2/c1-2-16-12-10(5-8(14)6-15-12)9-3-4-18-7-11(9)13(16)17/h5-6,9,11H,2-4,7H2,1H3/t9-,11+/m0/s1 |
| InChIKey | KLWOSPPAZJFCPC-GXSJLCMTSA-N |
| XLogP | 2.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |