C30H33F3N4O3S — CID 129248721
N-[3-[6-(tert-butylsulfinylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 129248721) has the molecular formula C30H33F3N4O3S and a molecular weight of 586.68 g/mol. Its IUPAC name is N-[3-[6-(tert-butylsulfinylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[6-(tert-butylsulfinylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129248721 |
| Molecular Formula | C30H33F3N4O3S |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | N-[3-[6-(tert-butylsulfinylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(F)(F)F)c2)cc1-c1ccc2c(c1)N1CCOCC1CC2NS(=O)C(C)(C)C |
| InChI | InChI=1S/C30H33F3N4O3S/c1-18-5-7-21(35-28(38)20-9-10-34-27(14-20)30(31,32)33)15-24(18)19-6-8-23-25(36-41(39)29(2,3)4)16-22-17-40-12-11-37(22)26(23)13-19/h5-10,13-15,22,25,36H,11-12,16-17H2,1-4H3,(H,35,38) |
| InChIKey | YCSORLUICPSPSZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |