C10H12ClN3O2 — CID 129248823
(8S,10S)-4-chloro-12-oxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-8-ol (PubChem CID 129248823) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is (8S,10S)-4-chloro-12-oxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-8-ol.
| Compound Name | (8S,10S)-4-chloro-12-oxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-8-ol |
|---|---|
| PubChem CID | 129248823 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (8S,10S)-4-chloro-12-oxa-1,5,6-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-8-ol |
| SMILES | O[C@H]1C[C@H]2COCCN2c2cc(Cl)nnc21 |
| InChI | InChI=1S/C10H12ClN3O2/c11-9-4-7-10(13-12-9)8(15)3-6-5-16-2-1-14(6)7/h4,6,8,15H,1-3,5H2/t6-,8-/m0/s1 |
| InChIKey | HKDUNIFSNAHGSM-XPUUQOCRSA-N |
| XLogP | 0.77 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |