C28H27F3N4O3 — CID 129248869
N-methyl-9-[2-methyl-5-[[2-(trifluoromethyl)pyridine-4-carbonyl]amino]phenyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide (PubChem CID 129248869) has the molecular formula C28H27F3N4O3 and a molecular weight of 524.54 g/mol. Its IUPAC name is N-methyl-9-[2-methyl-5-[[2-(trifluoromethyl)pyridine-4-carbonyl]amino]phenyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | N-methyl-9-[2-methyl-5-[[2-(trifluoromethyl)pyridine-4-carbonyl]amino]phenyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129248869 |
| Molecular Formula | C28H27F3N4O3 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-methyl-9-[2-methyl-5-[[2-(trifluoromethyl)pyridine-4-carbonyl]amino]phenyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide |
| SMILES | CNC(=O)C1Cc2ccc(-c3cc(NC(=O)c4ccnc(C(F)(F)F)c4)ccc3C)cc2N2CCOCC12 |
| InChI | InChI=1S/C28H27F3N4O3/c1-16-3-6-20(34-26(36)19-7-8-33-25(13-19)28(29,30)31)14-21(16)17-4-5-18-11-22(27(37)32-2)24-15-38-10-9-35(24)23(18)12-17/h3-8,12-14,22,24H,9-11,15H2,1-2H3,(H,32,37)(H,34,36) |
| InChIKey | MUCFHCMXEAZDTO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |