C28H29F2N3O3 — CID 129248915
N-[3-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide (PubChem CID 129248915) has the molecular formula C28H29F2N3O3 and a molecular weight of 493.55 g/mol. Its IUPAC name is N-[3-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129248915 |
| Molecular Formula | C28H29F2N3O3 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[3-[(4aR,6R)-6-methoxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide |
| SMILES | CO[C@@H]1C[C@@H]2COCCN2c2cc(-c3cc(NC(=O)c4ccnc(C(C)(F)F)c4)ccc3C)ccc21 |
| InChI | InChI=1S/C28H29F2N3O3/c1-17-4-6-20(32-27(34)19-8-9-31-26(13-19)28(2,29)30)14-23(17)18-5-7-22-24(12-18)33-10-11-36-16-21(33)15-25(22)35-3/h4-9,12-14,21,25H,10-11,15-16H2,1-3H3,(H,32,34)/t21-,25-/m1/s1 |
| InChIKey | GRMDTVVEJZOWMX-PXDATVDWSA-N |
| XLogP | 5.72 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |