C14H11F4NO3 — CID 129249018
(4S,5R)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-4-methyl-3-prop-2-enoyl-1,3-oxazolidin-2-one (PubChem CID 129249018) has the molecular formula C14H11F4NO3 and a molecular weight of 317.24 g/mol. Its IUPAC name is (4S,5R)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-4-methyl-3-prop-2-enoyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-4-methyl-3-prop-2-enoyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129249018 |
| Molecular Formula | C14H11F4NO3 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (4S,5R)-5-[3-fluoro-5-(trifluoromethyl)phenyl]-4-methyl-3-prop-2-enoyl-1,3-oxazolidin-2-one |
| SMILES | C=CC(=O)N1C(=O)O[C@H](c2cc(F)cc(C(F)(F)F)c2)[C@@H]1C |
| InChI | InChI=1S/C14H11F4NO3/c1-3-11(20)19-7(2)12(22-13(19)21)8-4-9(14(16,17)18)6-10(15)5-8/h3-7,12H,1H2,2H3/t7-,12-/m0/s1 |
| InChIKey | FMHCSEDVMDHVTM-MADCSZMMSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|