About 2,6-dicyclopropylaniline
2,6-dicyclopropylaniline (PubChem CID 129249080) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,6-dicyclopropylaniline.
Molecular Properties
| Compound Name | 2,6-dicyclopropylaniline |
| PubChem CID | 129249080 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2,6-dicyclopropylaniline |
| SMILES | Nc1c(C2CC2)cccc1C1CC1 |
| InChI | InChI=1S/C12H15N/c13-12-10(8-4-5-8)2-1-3-11(12)9-6-7-9/h1-3,8-9H,4-7,13H2 |
| InChIKey | BTWJHXDDGRUVCN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dicyclopropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dicyclopropylaniline?
The IUPAC name of 2,6-dicyclopropylaniline (CID 129249080) is 2,6-dicyclopropylaniline.
What is the SMILES notation for 2,6-dicyclopropylaniline?
The canonical SMILES for 2,6-dicyclopropylaniline is Nc1c(C2CC2)cccc1C1CC1.
What is the InChIKey of 2,6-dicyclopropylaniline?
The InChIKey is BTWJHXDDGRUVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c13-12-10(8-4-5-8)2-1-3-11(12)9-6-7-9/h1-3,8-9H,4-7,13H2.
What are the key properties of 2,6-dicyclopropylaniline?
2,6-dicyclopropylaniline has a molecular weight of 173.26 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dicyclopropylaniline is sourced from PubChem (CID 129249080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).