C21H23ClN6O2 — CID 129249142
1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethyl-8-piperidin-3-ylpurine-2,6-dione (PubChem CID 129249142) has the molecular formula C21H23ClN6O2 and a molecular weight of 426.91 g/mol. Its IUPAC name is 1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethyl-8-piperidin-3-ylpurine-2,6-dione.
| Compound Name | 1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethyl-8-piperidin-3-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 129249142 |
| Molecular Formula | C21H23ClN6O2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[(4-chloro-1H-indol-2-yl)methyl]-3,7-dimethyl-8-piperidin-3-ylpurine-2,6-dione |
| SMILES | Cn1c(C2CCCNC2)nc2c1c(=O)n(Cc1cc3c(Cl)cccc3[nH]1)c(=O)n2C |
| InChI | InChI=1S/C21H23ClN6O2/c1-26-17-19(25-18(26)12-5-4-8-23-10-12)27(2)21(30)28(20(17)29)11-13-9-14-15(22)6-3-7-16(14)24-13/h3,6-7,9,12,23-24H,4-5,8,10-11H2,1-2H3 |
| InChIKey | JZLIFWYOIFIHHG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |