C18H23Cl2N5O3 — CID 129249257
1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[[(3S)-oxolan-3-yl]amino]-4,5,8,9-tetrahydropurine-2,6-dione (PubChem CID 129249257) has the molecular formula C18H23Cl2N5O3 and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[[(3S)-oxolan-3-yl]amino]-4,5,8,9-tetrahydropurine-2,6-dione.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[[(3S)-oxolan-3-yl]amino]-4,5,8,9-tetrahydropurine-2,6-dione |
|---|---|
| PubChem CID | 129249257 |
| Molecular Formula | C18H23Cl2N5O3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[[(3S)-oxolan-3-yl]amino]-4,5,8,9-tetrahydropurine-2,6-dione |
| SMILES | CN1C(=O)N(Cc2ccc(Cl)c(Cl)c2)C(=O)C2C1NC(N[C@H]1CCOC1)N2C |
| InChI | InChI=1S/C18H23Cl2N5O3/c1-23-14-15(22-17(23)21-11-5-6-28-9-11)24(2)18(27)25(16(14)26)8-10-3-4-12(19)13(20)7-10/h3-4,7,11,14-15,17,21-22H,5-6,8-9H2,1-2H3/t11-,14?,15?,17?/m0/s1 |
| InChIKey | ITPCOMPXLGFULO-WFVCENDPSA-N |
| XLogP | 1.28 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |