About 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid
2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid (PubChem CID 129249300) has the molecular formula C17H12BrClFN5O4
and a molecular weight of 484.67 g/mol. Its IUPAC name is 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid |
| PubChem CID | 129249300 |
| Molecular Formula | C17H12BrClFN5O4 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid |
| SMILES | Cn1c(Br)nc2c1c(=O)n(Cc1cc3c(Cl)ccc(F)c3n1C(=O)O)c(=O)n2C |
| InChI | InChI=1S/C17H12BrClFN5O4/c1-22-12-13(21-15(22)18)23(2)16(27)24(14(12)26)6-7-5-8-9(19)3-4-10(20)11(8)25(7)17(28)29/h3-5H,6H2,1-2H3,(H,28,29) |
| InChIKey | HZFGYAGJUJDWCD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid?
The IUPAC name of 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid (CID 129249300) is 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid.
What is the SMILES notation for 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid?
The canonical SMILES for 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid is Cn1c(Br)nc2c1c(=O)n(Cc1cc3c(Cl)ccc(F)c3n1C(=O)O)c(=O)n2C.
What is the InChIKey of 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid?
The InChIKey is HZFGYAGJUJDWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrClFN5O4/c1-22-12-13(21-15(22)18)23(2)16(27)24(14(12)26)6-7-5-8-9(19)3-4-10(20)11(8)25(7)17(28)29/h3-5H,6H2,1-2H3,(H,28,29).
What are the key properties of 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid?
2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid has a molecular weight of 484.67 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-bromo-3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-4-chloro-7-fluoroindole-1-carboxylic acid is sourced from PubChem (CID 129249300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).