C23H30Cl2N6O5 — CID 129249421
3-[[7-(3-amino-3-oxopropyl)-1-[(3,4-dichlorophenyl)methyl]-3-methyl-2,6-dioxo-4,5,8,9-tetrahydropurin-8-yl]amino]cyclohexane-1-carboxylic acid (PubChem CID 129249421) has the molecular formula C23H30Cl2N6O5 and a molecular weight of 541.44 g/mol. Its IUPAC name is 3-[[7-(3-amino-3-oxopropyl)-1-[(3,4-dichlorophenyl)methyl]-3-methyl-2,6-dioxo-4,5,8,9-tetrahydropurin-8-yl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[7-(3-amino-3-oxopropyl)-1-[(3,4-dichlorophenyl)methyl]-3-methyl-2,6-dioxo-4,5,8,9-tetrahydropurin-8-yl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129249421 |
| Molecular Formula | C23H30Cl2N6O5 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 3-[[7-(3-amino-3-oxopropyl)-1-[(3,4-dichlorophenyl)methyl]-3-methyl-2,6-dioxo-4,5,8,9-tetrahydropurin-8-yl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CN1C(=O)N(Cc2ccc(Cl)c(Cl)c2)C(=O)C2C1NC(NC1CCCC(C(=O)O)C1)N2CCC(N)=O |
| InChI | InChI=1S/C23H30Cl2N6O5/c1-29-19-18(20(33)31(23(29)36)11-12-5-6-15(24)16(25)9-12)30(8-7-17(26)32)22(28-19)27-14-4-2-3-13(10-14)21(34)35/h5-6,9,13-14,18-19,22,27-28H,2-4,7-8,10-11H2,1H3,(H2,26,32)(H,34,35) |
| InChIKey | PTTFECBRZSDUSA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |