About 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide
4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide (PubChem CID 129251191) has the molecular formula C19H22N4O2S
and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide.
Molecular Properties
| Compound Name | 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide |
| PubChem CID | 129251191 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide |
| SMILES | CC(=O)Nc1ncc(CN2CCC(=Cc3ccc(C(N)=O)cc3)CC2)s1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13(24)22-19-21-11-17(26-19)12-23-8-6-15(7-9-23)10-14-2-4-16(5-3-14)18(20)25/h2-5,10-11H,6-9,12H2,1H3,(H2,20,25)(H,21,22,24) |
| InChIKey | JBGRZHYNUVYNBE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide?
The IUPAC name of 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide (CID 129251191) is 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide.
What is the SMILES notation for 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide?
The canonical SMILES for 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide is CC(=O)Nc1ncc(CN2CCC(=Cc3ccc(C(N)=O)cc3)CC2)s1.
What is the InChIKey of 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide?
The InChIKey is JBGRZHYNUVYNBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2S/c1-13(24)22-19-21-11-17(26-19)12-23-8-6-15(7-9-23)10-14-2-4-16(5-3-14)18(20)25/h2-5,10-11H,6-9,12H2,1H3,(H2,20,25)(H,21,22,24).
What are the key properties of 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide?
4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide has a molecular weight of 370.48 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-[(2-acetamido-1,3-thiazol-5-yl)methyl]piperidin-4-ylidene]methyl]benzamide is sourced from PubChem (CID 129251191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).