C26H25ClFN7O4 — CID 129251764
tert-butyl 4-chloro-2-[[8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate (PubChem CID 129251764) has the molecular formula C26H25ClFN7O4 and a molecular weight of 553.98 g/mol. Its IUPAC name is tert-butyl 4-chloro-2-[[8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 4-chloro-2-[[8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 129251764 |
| Molecular Formula | C26H25ClFN7O4 |
| Molecular Weight | 553.98 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | tert-butyl 4-chloro-2-[[8-[(6-fluoro-3-pyridinyl)amino]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate |
| SMILES | Cn1c(Nc2ccc(F)nc2)nc2c1c(=O)n(Cc1cc3c(Cl)cccc3n1C(=O)OC(C)(C)C)c(=O)n2C |
| InChI | InChI=1S/C26H25ClFN7O4/c1-26(2,3)39-25(38)35-15(11-16-17(27)7-6-8-18(16)35)13-34-22(36)20-21(33(5)24(34)37)31-23(32(20)4)30-14-9-10-19(28)29-12-14/h6-12H,13H2,1-5H3,(H,30,31) |
| InChIKey | UDVXCXHPUQGVPH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.98 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|