C21H31F3O3 — CID 129252040
2,3,5-trimethyl-6-[10-(2,2,2-trifluoroethoxy)decyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 129252040) has the molecular formula C21H31F3O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[10-(2,2,2-trifluoroethoxy)decyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-[10-(2,2,2-trifluoroethoxy)decyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 129252040 |
| Molecular Formula | C21H31F3O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2,3,5-trimethyl-6-[10-(2,2,2-trifluoroethoxy)decyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCCCCCCCCCOCC(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C21H31F3O3/c1-15-16(2)20(26)18(17(3)19(15)25)12-10-8-6-4-5-7-9-11-13-27-14-21(22,23)24/h4-14H2,1-3H3 |
| InChIKey | QGDLWQFFQHCHEJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|