C12H17FN2 — CID 129252823
3-(1-ethylpyrrolidin-2-yl)-5-fluoro-2-methylpyridine (PubChem CID 129252823) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-(1-ethylpyrrolidin-2-yl)-5-fluoro-2-methylpyridine.
| Compound Name | 3-(1-ethylpyrrolidin-2-yl)-5-fluoro-2-methylpyridine |
|---|---|
| PubChem CID | 129252823 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 3-(1-ethylpyrrolidin-2-yl)-5-fluoro-2-methylpyridine |
| SMILES | CCN1CCCC1c1cc(F)cnc1C |
| InChI | InChI=1S/C12H17FN2/c1-3-15-6-4-5-12(15)11-7-10(13)8-14-9(11)2/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | ZCYCVWYMOUGQEE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |