C32H48O13 — CID 129253423
6-[1-carboxy-3,3-dimethyl-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]butyl]-2-(2,2-dimethylpropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]oxane-3-carboxylic acid (PubChem CID 129253423) has the molecular formula C32H48O13 and a molecular weight of 640.72 g/mol. Its IUPAC name is 6-[1-carboxy-3,3-dimethyl-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]butyl]-2-(2,2-dimethylpropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]oxane-3-carboxylic acid.
| Compound Name | 6-[1-carboxy-3,3-dimethyl-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]butyl]-2-(2,2-dimethylpropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 129253423 |
| Molecular Formula | C32H48O13 |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 6-[1-carboxy-3,3-dimethyl-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]butyl]-2-(2,2-dimethylpropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]oxane-3-carboxylic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(C(=O)O)C(C(=O)OCCOC(=O)C(=C)C)C(C)(C)C)OC(CC(C)(C)C)C1C(=O)O |
| InChI | InChI=1S/C32H48O13/c1-17(2)27(37)41-11-13-43-29(39)19-15-20(45-21(16-31(5,6)7)22(19)25(33)34)23(26(35)36)24(32(8,9)10)30(40)44-14-12-42-28(38)18(3)4/h19-24H,1,3,11-16H2,2,4-10H3,(H,33,34)(H,35,36) |
| InChIKey | NMSFKFVAMUQEIK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|