About 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene
11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene (PubChem CID 129254012) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene.
Molecular Properties
| Compound Name | 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene |
| PubChem CID | 129254012 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene |
| SMILES | C1=CC2=C3C=CC(O3)C2NC1 |
| InChI | InChI=1S/C9H9NO/c1-2-6-7-3-4-8(11-7)9(6)10-5-1/h1-4,8-10H,5H2 |
| InChIKey | LNZFWGAWJXNJHR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene?
The IUPAC name of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene (CID 129254012) is 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene.
What is the SMILES notation for 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene?
The canonical SMILES for 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene is C1=CC2=C3C=CC(O3)C2NC1.
What is the InChIKey of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene?
The InChIKey is LNZFWGAWJXNJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-2-6-7-3-4-8(11-7)9(6)10-5-1/h1-4,8-10H,5H2.
What are the key properties of 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene?
11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene has a molecular weight of 147.18 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-5,7,9-triene is sourced from PubChem (CID 129254012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).