C17H19NO — CID 129254151
(2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienamide (PubChem CID 129254151) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienamide.
| Compound Name | (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienamide |
|---|---|
| PubChem CID | 129254151 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienamide |
| SMILES | C=C/C=C\C(=C/C=C)NC(=O)C(/C=C\C=C)=C/C=C |
| InChI | InChI=1S/C17H19NO/c1-5-9-13-15(11-7-3)17(19)18-16(12-8-4)14-10-6-2/h5-14H,1-4H2,(H,18,19)/b13-9-,14-10-,15-11+,16-12+ |
| InChIKey | IZZUPQBYTKNHOX-NTJPYOIESA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|