About 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine
3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine (PubChem CID 129254233) has the molecular formula C12H16FN
and a molecular weight of 193.26 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine |
| PubChem CID | 129254233 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(F)CC1=CCCC=C1 |
| InChI | InChI=1S/C12H16FN/c1-2-8-14-10-12(13)9-11-6-4-3-5-7-11/h1,4,6-7,12,14H,3,5,8-10H2 |
| InChIKey | MBUXREJZVCKWLX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine (CID 129254233) is 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine is C#CCNCC(F)CC1=CCCC=C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine?
The InChIKey is MBUXREJZVCKWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN/c1-2-8-14-10-12(13)9-11-6-4-3-5-7-11/h1,4,6-7,12,14H,3,5,8-10H2.
What are the key properties of 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine?
3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine has a molecular weight of 193.26 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yl-2-fluoro-N-prop-2-ynylpropan-1-amine is sourced from PubChem (CID 129254233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).