C30H48N2O6 — CID 129254267
[(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-tert-butyl-N-methylcarbamate (PubChem CID 129254267) has the molecular formula C30H48N2O6 and a molecular weight of 532.72 g/mol. Its IUPAC name is [(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-tert-butyl-N-methylcarbamate.
| Compound Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 129254267 |
| Molecular Formula | C30H48N2O6 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-tert-butyl-N-methylcarbamate |
| SMILES | CC(/C=C/[C@@H]1CC2(CC2)CC(C)(C)O1)=C\CC1OCC(NC(=O)/C=C\[C@H](C)OC(=O)N(C)C(C)(C)C)CO1 |
| InChI | InChI=1S/C30H48N2O6/c1-21(9-12-24-17-30(15-16-30)20-29(6,7)38-24)10-14-26-35-18-23(19-36-26)31-25(33)13-11-22(2)37-27(34)32(8)28(3,4)5/h9-13,22-24,26H,14-20H2,1-8H3,(H,31,33)/b12-9+,13-11-,21-10+/t22-,23?,24+,26?/m0/s1 |
| InChIKey | SZOCCKPEEJMBRE-LYFYNKOHSA-N |
| XLogP | 5.29 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|