C29H46N2O6 — CID 129254273
[(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-butylcarbamate (PubChem CID 129254273) has the molecular formula C29H46N2O6 and a molecular weight of 518.70 g/mol. Its IUPAC name is [(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-butylcarbamate.
| Compound Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 129254273 |
| Molecular Formula | C29H46N2O6 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | [(Z,2S)-5-[[2-[(2E,4E)-5-[(5S)-7,7-dimethyl-6-oxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-1,3-dioxan-5-yl]amino]-5-oxopent-3-en-2-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)O[C@@H](C)/C=C\C(=O)NC1COC(C/C=C(C)/C=C/[C@@H]2CC3(CC3)CC(C)(C)O2)OC1 |
| InChI | InChI=1S/C29H46N2O6/c1-6-7-16-30-27(33)36-22(3)10-12-25(32)31-23-18-34-26(35-19-23)13-9-21(2)8-11-24-17-29(14-15-29)20-28(4,5)37-24/h8-12,22-24,26H,6-7,13-20H2,1-5H3,(H,30,33)(H,31,32)/b11-8+,12-10-,21-9+/t22-,23?,24+,26?/m0/s1 |
| InChIKey | CBBRFBBPFFSOFH-RCDWJVNASA-N |
| XLogP | 4.95 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|