C20H14N6O3 — CID 1292557
3-(3-nitrophenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide (PubChem CID 1292557) has the molecular formula C20H14N6O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide.
| Compound Name | 3-(3-nitrophenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1292557 |
| Molecular Formula | C20H14N6O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-(3-nitrophenyl)-N-(7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)Nc1nc2nccc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C20H14N6O3/c27-18(10-9-14-5-4-8-16(13-14)26(28)29)22-19-23-20-21-12-11-17(25(20)24-19)15-6-2-1-3-7-15/h1-13H,(H,22,24,27) |
| InChIKey | KRZAIZDAFMJBOK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|