About 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one
5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one (PubChem CID 129255791) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one |
| PubChem CID | 129255791 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one |
| SMILES | CC(C)(C)C(=O)COCc1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C12H17NO3/c1-12(2,3)10(14)8-16-7-9-4-5-11(15)13-6-9/h4-6H,7-8H2,1-3H3,(H,13,15) |
| InChIKey | KOTCGGOHCOAHEY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one?
The IUPAC name of 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one (CID 129255791) is 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one.
What is the SMILES notation for 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one?
The canonical SMILES for 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one is CC(C)(C)C(=O)COCc1ccc(=O)[nH]c1.
What is the InChIKey of 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one?
The InChIKey is KOTCGGOHCOAHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-12(2,3)10(14)8-16-7-9-4-5-11(15)13-6-9/h4-6H,7-8H2,1-3H3,(H,13,15).
What are the key properties of 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one?
5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one has a molecular weight of 223.27 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,3-dimethyl-2-oxobutoxy)methyl]-1H-pyridin-2-one is sourced from PubChem (CID 129255791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).