About [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate
[2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate (PubChem CID 129256142) has the molecular formula C8H14F2NO5P
and a molecular weight of 273.17 g/mol. Its IUPAC name is [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate |
| PubChem CID | 129256142 |
| Molecular Formula | C8H14F2NO5P |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate |
| SMILES | C[C@H]1CCN(C(=O)COP(=O)(O)O)CC1(F)F |
| InChI | InChI=1S/C8H14F2NO5P/c1-6-2-3-11(5-8(6,9)10)7(12)4-16-17(13,14)15/h6H,2-5H2,1H3,(H2,13,14,15)/t6-/m0/s1 |
| InChIKey | GYNXSNKCBHCAST-LURJTMIESA-N |
| XLogP | 0.60 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate?
The IUPAC name of [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate (CID 129256142) is [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate.
What is the SMILES notation for [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate?
The canonical SMILES for [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate is C[C@H]1CCN(C(=O)COP(=O)(O)O)CC1(F)F.
What is the InChIKey of [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate?
The InChIKey is GYNXSNKCBHCAST-LURJTMIESA-N. The full InChI is InChI=1S/C8H14F2NO5P/c1-6-2-3-11(5-8(6,9)10)7(12)4-16-17(13,14)15/h6H,2-5H2,1H3,(H2,13,14,15)/t6-/m0/s1.
What are the key properties of [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate?
[2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate has a molecular weight of 273.17 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4S)-3,3-difluoro-4-methylpiperidin-1-yl]-2-oxoethyl] dihydrogen phosphate is sourced from PubChem (CID 129256142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).