About N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine
N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine (PubChem CID 129256150) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine |
| PubChem CID | 129256150 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine |
| SMILES | C[C@@H]1C[C@H]1CN(C)C |
| InChI | InChI=1S/C7H15N/c1-6-4-7(6)5-8(2)3/h6-7H,4-5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | VNOMCPMMJPDPTF-RQJHMYQMSA-N |
| XLogP | 1.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine?
The IUPAC name of N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine (CID 129256150) is N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine.
What is the SMILES notation for N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine?
The canonical SMILES for N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine is C[C@@H]1C[C@H]1CN(C)C.
What is the InChIKey of N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine?
The InChIKey is VNOMCPMMJPDPTF-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H15N/c1-6-4-7(6)5-8(2)3/h6-7H,4-5H2,1-3H3/t6-,7+/m1/s1.
What are the key properties of N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine?
N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine has a molecular weight of 113.20 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-[(1R,2R)-2-methylcyclopropyl]methanamine is sourced from PubChem (CID 129256150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).