About 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone
2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone (PubChem CID 129256153) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone.
Molecular Properties
| Compound Name | 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone |
| PubChem CID | 129256153 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone |
| SMILES | COCC(=O)[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C7H12O2/c1-5-3-6(5)7(8)4-9-2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | QTDUFYAOKOLFEU-PHDIDXHHSA-N |
| XLogP | 0.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone?
The IUPAC name of 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone (CID 129256153) is 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone.
What is the SMILES notation for 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone?
The canonical SMILES for 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone is COCC(=O)[C@@H]1C[C@H]1C.
What is the InChIKey of 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone?
The InChIKey is QTDUFYAOKOLFEU-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H12O2/c1-5-3-6(5)7(8)4-9-2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone?
2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone has a molecular weight of 128.17 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-[(1R,2R)-2-methylcyclopropyl]ethanone is sourced from PubChem (CID 129256153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).