C27H33FN4O5 — CID 129256207
cis-(1R,2S)-2-N-[3-[3-(aminomethyl)-4-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxyphenyl]phenyl]-1-N,1-N-dimethylcyclopropane-1,2-dicarboxamide (PubChem CID 129256207) has the molecular formula C27H33FN4O5 and a molecular weight of 512.58 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-[3-[3-(aminomethyl)-4-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxyphenyl]phenyl]-1-N,1-N-dimethylcyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-2-N-[3-[3-(aminomethyl)-4-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxyphenyl]phenyl]-1-N,1-N-dimethylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 129256207 |
| Molecular Formula | C27H33FN4O5 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | cis-(1R,2S)-2-N-[3-[3-(aminomethyl)-4-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxyphenyl]phenyl]-1-N,1-N-dimethylcyclopropane-1,2-dicarboxamide |
| SMILES | CN(C)C(=O)[C@@H]1C[C@@H]1C(=O)Nc1cccc(-c2ccc(O[C@H]3CCN(C(=O)CO)C[C@H]3F)c(CN)c2)c1 |
| InChI | InChI=1S/C27H33FN4O5/c1-31(2)27(36)21-12-20(21)26(35)30-19-5-3-4-16(11-19)17-6-7-23(18(10-17)13-29)37-24-8-9-32(14-22(24)28)25(34)15-33/h3-7,10-11,20-22,24,33H,8-9,12-15,29H2,1-2H3,(H,30,35)/t20-,21+,22+,24-/m0/s1 |
| InChIKey | DAEJBVGKXORYTL-NXYDZRKXSA-N |
| XLogP | 1.79 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |