About ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate
ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate (PubChem CID 129256885) has the molecular formula C13H19F2NO3
and a molecular weight of 275.30 g/mol. Its IUPAC name is ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate.
Molecular Properties
| Compound Name | ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate |
| PubChem CID | 129256885 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate |
| SMILES | CCOC(=O)C(F)(F)CCc1coc(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H19F2NO3/c1-5-18-11(17)13(14,15)7-6-9-8-19-10(16-9)12(2,3)4/h8H,5-7H2,1-4H3 |
| InChIKey | KYOUSUKKGCPWBH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate?
The IUPAC name of ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate (CID 129256885) is ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate.
What is the SMILES notation for ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate?
The canonical SMILES for ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate is CCOC(=O)C(F)(F)CCc1coc(C(C)(C)C)n1.
What is the InChIKey of ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate?
The InChIKey is KYOUSUKKGCPWBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2NO3/c1-5-18-11(17)13(14,15)7-6-9-8-19-10(16-9)12(2,3)4/h8H,5-7H2,1-4H3.
What are the key properties of ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate?
ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate has a molecular weight of 275.30 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-difluorobutanoate is sourced from PubChem (CID 129256885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).