About 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one
1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one (PubChem CID 129257201) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one.
Molecular Properties
| Compound Name | 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one |
| PubChem CID | 129257201 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one |
| SMILES | CCC(C)(C)CCC(=O)C1=CCCC1 |
| InChI | InChI=1S/C13H22O/c1-4-13(2,3)10-9-12(14)11-7-5-6-8-11/h7H,4-6,8-10H2,1-3H3 |
| InChIKey | PCEWSQBLGNTLFI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one?
The IUPAC name of 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one (CID 129257201) is 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one.
What is the SMILES notation for 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one?
The canonical SMILES for 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one is CCC(C)(C)CCC(=O)C1=CCCC1.
What is the InChIKey of 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one?
The InChIKey is PCEWSQBLGNTLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-4-13(2,3)10-9-12(14)11-7-5-6-8-11/h7H,4-6,8-10H2,1-3H3.
What are the key properties of 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one?
1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one has a molecular weight of 194.32 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopenten-1-yl)-4,4-dimethylhexan-1-one is sourced from PubChem (CID 129257201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).