C17H16N4O2S — CID 129257422
3-amino-N-(4-hydroxyphenyl)-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxamide (PubChem CID 129257422) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-amino-N-(4-hydroxyphenyl)-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxamide.
| Compound Name | 3-amino-N-(4-hydroxyphenyl)-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 129257422 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-amino-N-(4-hydroxyphenyl)-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(O)cc2)sc2nc3c(cc12)CNCC3 |
| InChI | InChI=1S/C17H16N4O2S/c18-14-12-7-9-8-19-6-5-13(9)21-17(12)24-15(14)16(23)20-10-1-3-11(22)4-2-10/h1-4,7,19,22H,5-6,8,18H2,(H,20,23) |
| InChIKey | HDIPIGSYSPXMNI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|