About 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine
1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine (PubChem CID 129258259) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine |
| PubChem CID | 129258259 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine |
| SMILES | Cc1cc(N2CC(C)CC(C)C2)ccc1C(C)(C)C |
| InChI | InChI=1S/C18H29N/c1-13-9-14(2)12-19(11-13)16-7-8-17(15(3)10-16)18(4,5)6/h7-8,10,13-14H,9,11-12H2,1-6H3 |
| InChIKey | LXJPRNHMMHSVST-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine?
The IUPAC name of 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine (CID 129258259) is 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine.
What is the SMILES notation for 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine?
The canonical SMILES for 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine is Cc1cc(N2CC(C)CC(C)C2)ccc1C(C)(C)C.
What is the InChIKey of 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine?
The InChIKey is LXJPRNHMMHSVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-13-9-14(2)12-19(11-13)16-7-8-17(15(3)10-16)18(4,5)6/h7-8,10,13-14H,9,11-12H2,1-6H3.
What are the key properties of 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine?
1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine has a molecular weight of 259.44 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-3-methylphenyl)-3,5-dimethylpiperidine is sourced from PubChem (CID 129258259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).