About 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine
1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine (PubChem CID 129258302) has the molecular formula C17H33FN2
and a molecular weight of 284.46 g/mol. Its IUPAC name is 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine.
Molecular Properties
| Compound Name | 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine |
| PubChem CID | 129258302 |
| Molecular Formula | C17H33FN2 |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine |
| SMILES | CC1CN(C2CCN(C(C)(C)C)CC2)CC(C)C1(C)F |
| InChI | InChI=1S/C17H33FN2/c1-13-11-19(12-14(2)17(13,6)18)15-7-9-20(10-8-15)16(3,4)5/h13-15H,7-12H2,1-6H3 |
| InChIKey | UWIBWNZOTMYRPJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine?
The IUPAC name of 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine (CID 129258302) is 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine.
What is the SMILES notation for 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine?
The canonical SMILES for 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine is CC1CN(C2CCN(C(C)(C)C)CC2)CC(C)C1(C)F.
What is the InChIKey of 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine?
The InChIKey is UWIBWNZOTMYRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33FN2/c1-13-11-19(12-14(2)17(13,6)18)15-7-9-20(10-8-15)16(3,4)5/h13-15H,7-12H2,1-6H3.
What are the key properties of 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine?
1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine has a molecular weight of 284.46 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-tert-butylpiperidin-4-yl)-4-fluoro-3,4,5-trimethylpiperidine is sourced from PubChem (CID 129258302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).