About 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine
3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine (PubChem CID 129258348) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine.
Molecular Properties
| Compound Name | 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine |
| PubChem CID | 129258348 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine |
| SMILES | CC1CC(C)CN(c2ccc(C(C)(C)C)nn2)C1 |
| InChI | InChI=1S/C15H25N3/c1-11-8-12(2)10-18(9-11)14-7-6-13(16-17-14)15(3,4)5/h6-7,11-12H,8-10H2,1-5H3 |
| InChIKey | VNGAGFHYMUKGDT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine?
The IUPAC name of 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine (CID 129258348) is 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine.
What is the SMILES notation for 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine?
The canonical SMILES for 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine is CC1CC(C)CN(c2ccc(C(C)(C)C)nn2)C1.
What is the InChIKey of 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine?
The InChIKey is VNGAGFHYMUKGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3/c1-11-8-12(2)10-18(9-11)14-7-6-13(16-17-14)15(3,4)5/h6-7,11-12H,8-10H2,1-5H3.
What are the key properties of 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine?
3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine has a molecular weight of 247.39 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6-(3,5-dimethylpiperidin-1-yl)pyridazine is sourced from PubChem (CID 129258348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).