C35H22Br2N4 — CID 129258765
2,4-bis(4-bromonaphthalen-1-yl)-6-[6-(4-methylphenyl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 129258765) has the molecular formula C35H22Br2N4 and a molecular weight of 658.40 g/mol. Its IUPAC name is 2,4-bis(4-bromonaphthalen-1-yl)-6-[6-(4-methylphenyl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-bromonaphthalen-1-yl)-6-[6-(4-methylphenyl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 129258765 |
| Molecular Formula | C35H22Br2N4 |
| Molecular Weight | 658.40 g/mol |
| Exact Mass | 656.02 |
| IUPAC Name | 2,4-bis(4-bromonaphthalen-1-yl)-6-[6-(4-methylphenyl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | Cc1ccc(-c2ccc(-c3nc(-c4ccc(Br)c5ccccc45)nc(-c4ccc(Br)c5ccccc45)n3)cn2)cc1 |
| InChI | InChI=1S/C35H22Br2N4/c1-21-10-12-22(13-11-21)32-19-14-23(20-38-32)33-39-34(28-15-17-30(36)26-8-4-2-6-24(26)28)41-35(40-33)29-16-18-31(37)27-9-5-3-7-25(27)29/h2-20H,1H3 |
| InChIKey | GPARSLGJUZJPJW-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.40 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |