C16H10Cl2FNO — CID 129259210
(2,4-dichloro-5-fluorophenyl)-(5-methylindol-1-yl)methanone (PubChem CID 129259210) has the molecular formula C16H10Cl2FNO and a molecular weight of 322.17 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-(5-methylindol-1-yl)methanone.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-(5-methylindol-1-yl)methanone |
|---|---|
| PubChem CID | 129259210 |
| Molecular Formula | C16H10Cl2FNO |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-(5-methylindol-1-yl)methanone |
| SMILES | Cc1ccc2c(ccn2C(=O)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H10Cl2FNO/c1-9-2-3-15-10(6-9)4-5-20(15)16(21)11-7-14(19)13(18)8-12(11)17/h2-8H,1H3 |
| InChIKey | HTBGZZAHKDNLQT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|