C13H10O5 — CID 12925972
5-acetylspiro[1-benzofuran-2,3'-oxolane]-2',3-dione (PubChem CID 12925972) has the molecular formula C13H10O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is 5-acetylspiro[1-benzofuran-2,3'-oxolane]-2',3-dione.
| Compound Name | 5-acetylspiro[1-benzofuran-2,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 12925972 |
| Molecular Formula | C13H10O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 5-acetylspiro[1-benzofuran-2,3'-oxolane]-2',3-dione |
| SMILES | CC(=O)c1ccc2c(c1)C(=O)C1(CCOC1=O)O2 |
| InChI | InChI=1S/C13H10O5/c1-7(14)8-2-3-10-9(6-8)11(15)13(18-10)4-5-17-12(13)16/h2-3,6H,4-5H2,1H3 |
| InChIKey | MVOUQENOPNLEHG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|