About N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine
N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine (PubChem CID 129259985) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine.
Molecular Properties
| Compound Name | N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine |
| PubChem CID | 129259985 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine |
| SMILES | CC/C=N/C=C(\C)C(C)C |
| InChI | InChI=1S/C9H17N/c1-5-6-10-7-9(4)8(2)3/h6-8H,5H2,1-4H3/b9-7+,10-6+ |
| InChIKey | VTMBMHNVSGRTIJ-IDXDHNASSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine?
The IUPAC name of N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine (CID 129259985) is N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine.
What is the SMILES notation for N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine?
The canonical SMILES for N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine is CC/C=N/C=C(\C)C(C)C.
What is the InChIKey of N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine?
The InChIKey is VTMBMHNVSGRTIJ-IDXDHNASSA-N. The full InChI is InChI=1S/C9H17N/c1-5-6-10-7-9(4)8(2)3/h6-8H,5H2,1-4H3/b9-7+,10-6+.
What are the key properties of N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine?
N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine has a molecular weight of 139.24 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2,3-dimethylbut-1-enyl]propan-1-imine is sourced from PubChem (CID 129259985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).