About (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine
(1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine (PubChem CID 129260100) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine.
Molecular Properties
| Compound Name | (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine |
| PubChem CID | 129260100 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine |
| SMILES | C=NN(C)/C=C1/C=CC=CC1 |
| InChI | InChI=1S/C9H12N2/c1-10-11(2)8-9-6-4-3-5-7-9/h3-6,8H,1,7H2,2H3/b9-8- |
| InChIKey | OFYNZMMTCRCSCE-HJWRWDBZSA-N |
| XLogP | 1.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine?
The IUPAC name of (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine (CID 129260100) is (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine.
What is the SMILES notation for (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine?
The canonical SMILES for (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine is C=NN(C)/C=C1/C=CC=CC1.
What is the InChIKey of (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine?
The InChIKey is OFYNZMMTCRCSCE-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H12N2/c1-10-11(2)8-9-6-4-3-5-7-9/h3-6,8H,1,7H2,2H3/b9-8-.
What are the key properties of (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine?
(1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine has a molecular weight of 148.21 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-cyclohexa-2,4-dien-1-ylidene-N-methyl-N-(methylideneamino)methanamine is sourced from PubChem (CID 129260100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).