C16H25F3N2 — CID 129260193
2-methyl-1-propan-2-yl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine (PubChem CID 129260193) has the molecular formula C16H25F3N2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-methyl-1-propan-2-yl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine.
| Compound Name | 2-methyl-1-propan-2-yl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 129260193 |
| Molecular Formula | C16H25F3N2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-methyl-1-propan-2-yl-4-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trien-2-yl]piperazine |
| SMILES | C=C/C(=C\C=C(/C)N1CCN(C(C)C)C(C)C1)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2/c1-6-15(16(17,18)19)8-7-13(4)20-9-10-21(12(2)3)14(5)11-20/h6-8,12,14H,1,9-11H2,2-5H3/b13-7+,15-8+ |
| InChIKey | UJHXURARGGDTEZ-KUADPSCUSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|