C13H12O6 — CID 129260232
(4,5-dihydroxycyclohexa-2,4-dien-1-yl)-(2,3,4-trihydroxyphenyl)methanone (PubChem CID 129260232) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is (4,5-dihydroxycyclohexa-2,4-dien-1-yl)-(2,3,4-trihydroxyphenyl)methanone.
| Compound Name | (4,5-dihydroxycyclohexa-2,4-dien-1-yl)-(2,3,4-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 129260232 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (4,5-dihydroxycyclohexa-2,4-dien-1-yl)-(2,3,4-trihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1O)C1C=CC(O)=C(O)C1 |
| InChI | InChI=1S/C13H12O6/c14-8-3-1-6(5-10(8)16)11(17)7-2-4-9(15)13(19)12(7)18/h1-4,6,14-16,18-19H,5H2 |
| InChIKey | QFODMABQLUZMRY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|