About 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane
1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane (PubChem CID 129260267) has the molecular formula C14H23FN2
and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane.
Molecular Properties
| Compound Name | 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane |
| PubChem CID | 129260267 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane |
| SMILES | CC1CCCNCCN(C2=CCC(F)C=C2)C1 |
| InChI | InChI=1S/C14H23FN2/c1-12-3-2-8-16-9-10-17(11-12)14-6-4-13(15)5-7-14/h4,6-7,12-13,16H,2-3,5,8-11H2,1H3 |
| InChIKey | GNPCYSMZTCMQFN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane?
The IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane (CID 129260267) is 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane.
What is the SMILES notation for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane?
The canonical SMILES for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane is CC1CCCNCCN(C2=CCC(F)C=C2)C1.
What is the InChIKey of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane?
The InChIKey is GNPCYSMZTCMQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23FN2/c1-12-3-2-8-16-9-10-17(11-12)14-6-4-13(15)5-7-14/h4,6-7,12-13,16H,2-3,5,8-11H2,1H3.
What are the key properties of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane?
1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane has a molecular weight of 238.35 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-8-methyl-1,4-diazonane is sourced from PubChem (CID 129260267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).