About 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol
2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol (PubChem CID 129260419) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol |
| PubChem CID | 129260419 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol |
| SMILES | C/C=C(\C=C/NCCO)CC |
| InChI | InChI=1S/C9H17NO/c1-3-9(4-2)5-6-10-7-8-11/h3,5-6,10-11H,4,7-8H2,1-2H3/b6-5-,9-3- |
| InChIKey | POLSAMYBOZRPBG-BLNURASBSA-N |
| XLogP | 1.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol?
The IUPAC name of 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol (CID 129260419) is 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol.
What is the SMILES notation for 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol?
The canonical SMILES for 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol is C/C=C(\C=C/NCCO)CC.
What is the InChIKey of 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol?
The InChIKey is POLSAMYBOZRPBG-BLNURASBSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-9(4-2)5-6-10-7-8-11/h3,5-6,10-11H,4,7-8H2,1-2H3/b6-5-,9-3-.
What are the key properties of 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol?
2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol has a molecular weight of 155.24 g/mol, XLogP of 1.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1Z,3Z)-3-ethylpenta-1,3-dienyl]amino]ethanol is sourced from PubChem (CID 129260419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).