C11H18N2O4 — CID 129260437
3-[2-(propanoylamino)pent-4-enoylamino]propanoic acid (PubChem CID 129260437) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[2-(propanoylamino)pent-4-enoylamino]propanoic acid.
| Compound Name | 3-[2-(propanoylamino)pent-4-enoylamino]propanoic acid |
|---|---|
| PubChem CID | 129260437 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[2-(propanoylamino)pent-4-enoylamino]propanoic acid |
| SMILES | C=CCC(NC(=O)CC)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C11H18N2O4/c1-3-5-8(13-9(14)4-2)11(17)12-7-6-10(15)16/h3,8H,1,4-7H2,2H3,(H,12,17)(H,13,14)(H,15,16) |
| InChIKey | ZYDHOMPRMASXGX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|