About 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone
1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone (PubChem CID 129260773) has the molecular formula C9H16FNO3
and a molecular weight of 205.23 g/mol. Its IUPAC name is 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone |
| PubChem CID | 129260773 |
| Molecular Formula | C9H16FNO3 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@H](OC)[C@H](F)C1 |
| InChI | InChI=1S/C9H16FNO3/c1-13-6-9(12)11-4-3-8(14-2)7(10)5-11/h7-8H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | XDRFKESAHDLUIA-SFYZADRCSA-N |
| XLogP | 0.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone?
The IUPAC name of 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone (CID 129260773) is 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone.
What is the SMILES notation for 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone?
The canonical SMILES for 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone is COCC(=O)N1CC[C@H](OC)[C@H](F)C1.
What is the InChIKey of 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone?
The InChIKey is XDRFKESAHDLUIA-SFYZADRCSA-N. The full InChI is InChI=1S/C9H16FNO3/c1-13-6-9(12)11-4-3-8(14-2)7(10)5-11/h7-8H,3-6H2,1-2H3/t7-,8+/m1/s1.
What are the key properties of 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone?
1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone has a molecular weight of 205.23 g/mol, XLogP of 0.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4S)-3-fluoro-4-methoxypiperidin-1-yl]-2-methoxyethanone is sourced from PubChem (CID 129260773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).