About [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate
[2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate (PubChem CID 129260985) has the molecular formula C12H20F2N2O4
and a molecular weight of 294.30 g/mol. Its IUPAC name is [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate |
| PubChem CID | 129260985 |
| Molecular Formula | C12H20F2N2O4 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate |
| SMILES | CCO[C@H]1CCN(C(=O)COC(=O)[C@H](C)N)CC1(F)F |
| InChI | InChI=1S/C12H20F2N2O4/c1-3-19-9-4-5-16(7-12(9,13)14)10(17)6-20-11(18)8(2)15/h8-9H,3-7,15H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | RXVQFXLWLVEINK-IUCAKERBSA-N |
| XLogP | 0.15 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate?
The IUPAC name of [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate (CID 129260985) is [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate.
What is the SMILES notation for [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate?
The canonical SMILES for [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate is CCO[C@H]1CCN(C(=O)COC(=O)[C@H](C)N)CC1(F)F.
What is the InChIKey of [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate?
The InChIKey is RXVQFXLWLVEINK-IUCAKERBSA-N. The full InChI is InChI=1S/C12H20F2N2O4/c1-3-19-9-4-5-16(7-12(9,13)14)10(17)6-20-11(18)8(2)15/h8-9H,3-7,15H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate?
[2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate has a molecular weight of 294.30 g/mol, XLogP of 0.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4S)-4-ethoxy-3,3-difluoropiperidin-1-yl]-2-oxoethyl] (2S)-2-aminopropanoate is sourced from PubChem (CID 129260985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).