About N-(4-methylcyclohexa-1,5-dien-1-yl)aniline
N-(4-methylcyclohexa-1,5-dien-1-yl)aniline (PubChem CID 129261105) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(4-methylcyclohexa-1,5-dien-1-yl)aniline.
Molecular Properties
| Compound Name | N-(4-methylcyclohexa-1,5-dien-1-yl)aniline |
| PubChem CID | 129261105 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(4-methylcyclohexa-1,5-dien-1-yl)aniline |
| SMILES | CC1C=CC(Nc2ccccc2)=CC1 |
| InChI | InChI=1S/C13H15N/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-7,9-11,14H,8H2,1H3 |
| InChIKey | HGSVXCUUAXHVKW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-methylcyclohexa-1,5-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
The IUPAC name of N-(4-methylcyclohexa-1,5-dien-1-yl)aniline (CID 129261105) is N-(4-methylcyclohexa-1,5-dien-1-yl)aniline.
What is the SMILES notation for N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
The canonical SMILES for N-(4-methylcyclohexa-1,5-dien-1-yl)aniline is CC1C=CC(Nc2ccccc2)=CC1.
What is the InChIKey of N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
The InChIKey is HGSVXCUUAXHVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-7,9-11,14H,8H2,1H3.
What are the key properties of N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
N-(4-methylcyclohexa-1,5-dien-1-yl)aniline has a molecular weight of 185.27 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylcyclohexa-1,5-dien-1-yl)aniline is sourced from PubChem (CID 129261105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).