About [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone
[(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 129261388) has the molecular formula C11H18F2N2O
and a molecular weight of 232.27 g/mol. Its IUPAC name is [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone |
| PubChem CID | 129261388 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)[C@]2(C)CC2(F)F)CC1 |
| InChI | InChI=1S/C11H18F2N2O/c1-3-14-4-6-15(7-5-14)9(16)10(2)8-11(10,12)13/h3-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZCBXJVAZZKMTSI-JTQLQIEISA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone?
The IUPAC name of [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone (CID 129261388) is [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone.
What is the SMILES notation for [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone?
The canonical SMILES for [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone is CCN1CCN(C(=O)[C@]2(C)CC2(F)F)CC1.
What is the InChIKey of [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone?
The InChIKey is ZCBXJVAZZKMTSI-JTQLQIEISA-N. The full InChI is InChI=1S/C11H18F2N2O/c1-3-14-4-6-15(7-5-14)9(16)10(2)8-11(10,12)13/h3-8H2,1-2H3/t10-/m0/s1.
What are the key properties of [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone?
[(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone has a molecular weight of 232.27 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-difluoro-1-methylcyclopropyl]-(4-ethylpiperazin-1-yl)methanone is sourced from PubChem (CID 129261388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).