C10H11NO4 — CID 12926159
(3S)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 12926159) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is (3S)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
| Compound Name | (3S)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 12926159 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (3S)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2cc(O)c(O)cc2CN1 |
| InChI | InChI=1S/C10H11NO4/c12-8-2-5-1-7(10(14)15)11-4-6(5)3-9(8)13/h2-3,7,11-13H,1,4H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | UIPNPFUNPXYKGP-ZETCQYMHSA-N |
| XLogP | 0.20 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|